C6H10Cl2O4 — CID 131218972
(2R,3R,4R,5R,6R)-5-chloro-6-(chloromethyl)oxane-2,3,4-triol (PubChem CID 131218972) has the molecular formula C6H10Cl2O4 and a molecular weight of 217.05 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-5-chloro-6-(chloromethyl)oxane-2,3,4-triol.
| Compound Name | (2R,3R,4R,5R,6R)-5-chloro-6-(chloromethyl)oxane-2,3,4-triol |
|---|---|
| PubChem CID | 131218972 |
| Molecular Formula | C6H10Cl2O4 |
| Molecular Weight | 217.05 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | (2R,3R,4R,5R,6R)-5-chloro-6-(chloromethyl)oxane-2,3,4-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](O)O[C@H](CCl)[C@@H]1Cl |
| InChI | InChI=1S/C6H10Cl2O4/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-6,9-11H,1H2/t2-,3+,4+,5-,6-/m1/s1 |
| InChIKey | ZIBMGOYQTGGDCE-FPRJBGLDSA-N |
| XLogP | -0.73 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.05 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|