C6H10Cl2O3 — CID 57315049
(3S,4R,5R,6R)-5-chloro-6-(chloromethyl)oxane-3,4-diol (PubChem CID 57315049) has the molecular formula C6H10Cl2O3 and a molecular weight of 201.05 g/mol. Its IUPAC name is (3S,4R,5R,6R)-5-chloro-6-(chloromethyl)oxane-3,4-diol.
| Compound Name | (3S,4R,5R,6R)-5-chloro-6-(chloromethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 57315049 |
| Molecular Formula | C6H10Cl2O3 |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | (3S,4R,5R,6R)-5-chloro-6-(chloromethyl)oxane-3,4-diol |
| SMILES | O[C@H]1[C@@H](Cl)[C@@H](CCl)OC[C@@H]1O |
| InChI | InChI=1S/C6H10Cl2O3/c7-1-4-5(8)6(10)3(9)2-11-4/h3-6,9-10H,1-2H2/t3-,4+,5-,6+/m0/s1 |
| InChIKey | YCHCUJUXEICVJP-BGPJRJDNSA-N |
| XLogP | -0.05 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|