C5H8Cl2O2 — CID 131093221
(2R,3S,4S)-4-chloro-2-(chloromethyl)oxolan-3-ol (PubChem CID 131093221) has the molecular formula C5H8Cl2O2 and a molecular weight of 171.02 g/mol. Its IUPAC name is (2R,3S,4S)-4-chloro-2-(chloromethyl)oxolan-3-ol.
| Compound Name | (2R,3S,4S)-4-chloro-2-(chloromethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 131093221 |
| Molecular Formula | C5H8Cl2O2 |
| Molecular Weight | 171.02 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | (2R,3S,4S)-4-chloro-2-(chloromethyl)oxolan-3-ol |
| SMILES | O[C@H]1[C@H](CCl)OC[C@@H]1Cl |
| InChI | InChI=1S/C5H8Cl2O2/c6-1-4-5(8)3(7)2-9-4/h3-5,8H,1-2H2/t3-,4-,5+/m0/s1 |
| InChIKey | BASKZLNLQCOEKO-VAYJURFESA-N |
| XLogP | 0.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.02 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|