C6H11ClO4 — CID 56626318
(3S,4R,5R,6R)-5-chloro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 56626318) has the molecular formula C6H11ClO4 and a molecular weight of 182.60 g/mol. Its IUPAC name is (3S,4R,5R,6R)-5-chloro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (3S,4R,5R,6R)-5-chloro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 56626318 |
| Molecular Formula | C6H11ClO4 |
| Molecular Weight | 182.60 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | (3S,4R,5R,6R)-5-chloro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OC[C@H]1OC[C@H](O)[C@@H](O)[C@H]1Cl |
| InChI | InChI=1S/C6H11ClO4/c7-5-4(1-8)11-2-3(9)6(5)10/h3-6,8-10H,1-2H2/t3-,4+,5-,6+/m0/s1 |
| InChIKey | ZXOQXGXTNOJOJC-BGPJRJDNSA-N |
| XLogP | -1.29 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.60 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|