C6H14O7S — CID 173247961
(2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol;methanesulfonic acid (PubChem CID 173247961) has the molecular formula C6H14O7S and a molecular weight of 230.24 g/mol. Its IUPAC name is (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol;methanesulfonic acid.
| Compound Name | (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol;methanesulfonic acid |
|---|---|
| PubChem CID | 173247961 |
| Molecular Formula | C6H14O7S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (2R,3S,4S)-2-(hydroxymethyl)oxolane-3,4-diol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.OC[C@H]1OC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H10O4.CH4O3S/c6-1-4-5(8)3(7)2-9-4;1-5(2,3)4/h3-8H,1-2H2;1H3,(H,2,3,4)/t3-,4+,5-;/m0./s1 |
| InChIKey | ZKZLENSWAMNZQD-VEGRVEBRSA-N |
| XLogP | -2.40 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|