C8H14NO8S- — CID 58596071
[(3R,4R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)oxan-3-yl] sulfate (PubChem CID 58596071) has the molecular formula C8H14NO8S- and a molecular weight of 284.27 g/mol. Its IUPAC name is [(3R,4R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)oxan-3-yl] sulfate.
| Compound Name | [(3R,4R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)oxan-3-yl] sulfate |
|---|---|
| PubChem CID | 58596071 |
| Molecular Formula | C8H14NO8S- |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | [(3R,4R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)oxan-3-yl] sulfate |
| SMILES | CC(=O)NC1COC(CO)[C@H](OS(=O)(=O)[O-])[C@@H]1O |
| InChI | InChI=1S/C8H15NO8S/c1-4(11)9-5-3-16-6(2-10)8(7(5)12)17-18(13,14)15/h5-8,10,12H,2-3H2,1H3,(H,9,11)(H,13,14,15)/p-1/t5?,6?,7-,8+/m1/s1 |
| InChIKey | YCRGAIIIPLSUQB-CRYROECRSA-M |
| XLogP | -2.91 |
| TPSA | 145.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|