C48H96O41 — CID 171703405
6-(hydroxymethyl)oxane-2,3,4,5-tetrol;heptakis(2-(hydroxymethyl)oxane-3,4,5-triol) (PubChem CID 171703405) has the molecular formula C48H96O41 and a molecular weight of 1329.26 g/mol. Its IUPAC name is 6-(hydroxymethyl)oxane-2,3,4,5-tetrol;heptakis(2-(hydroxymethyl)oxane-3,4,5-triol).
| Compound Name | 6-(hydroxymethyl)oxane-2,3,4,5-tetrol;heptakis(2-(hydroxymethyl)oxane-3,4,5-triol) |
|---|---|
| PubChem CID | 171703405 |
| Molecular Formula | C48H96O41 |
| Molecular Weight | 1329.26 g/mol |
| Exact Mass | 1328.54 |
| IUPAC Name | 6-(hydroxymethyl)oxane-2,3,4,5-tetrol;heptakis(2-(hydroxymethyl)oxane-3,4,5-triol) |
| SMILES | OCC1OC(O)C(O)C(O)C1O.OCC1OCC(O)C(O)C1O.OCC1OCC(O)C(O)C1O.OCC1OCC(O)C(O)C1O.OCC1OCC(O)C(O)C1O.OCC1OCC(O)C(O)C1O.OCC1OCC(O)C(O)C1O.OCC1OCC(O)C(O)C1O |
| InChI | InChI=1S/C6H12O6.7C6H12O5/c7-1-2-3(8)4(9)5(10)6(11)12-2;7*7-1-4-6(10)5(9)3(8)2-11-4/h2-11H,1H2;7*3-10H,1-2H2 |
| InChIKey | OIULVZGBOMVYDN-UHFFFAOYSA-N |
| XLogP | -21.00 |
| TPSA | 741.43 Ų |
| H-Bond Donors | 33 |
| H-Bond Acceptors | 41 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 89 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1329.26 |
| LogP ≤ 5 | -21.00 |
| H-Bond Donors ≤ 5 | 33 |
| H-Bond Acceptors ≤ 10 | 41 |