C7H14O4 — CID 134180059
(2S,3R,4S,5S)-2-ethyloxane-3,4,5-triol (PubChem CID 134180059) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-ethyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-ethyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 134180059 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (2S,3R,4S,5S)-2-ethyloxane-3,4,5-triol |
| SMILES | CC[C@@H]1OC[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H14O4/c1-2-5-7(10)6(9)4(8)3-11-5/h4-10H,2-3H2,1H3/t4-,5-,6-,7-/m0/s1 |
| InChIKey | PUZSHYWAWJRVFE-AXMZGBSTSA-N |
| XLogP | -1.12 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |