C7H14O3 — CID 148598014
(2S,3R,5S)-2-ethyloxane-3,5-diol (PubChem CID 148598014) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is (2S,3R,5S)-2-ethyloxane-3,5-diol.
| Compound Name | (2S,3R,5S)-2-ethyloxane-3,5-diol |
|---|---|
| PubChem CID | 148598014 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (2S,3R,5S)-2-ethyloxane-3,5-diol |
| SMILES | CC[C@@H]1OC[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C7H14O3/c1-2-7-6(9)3-5(8)4-10-7/h5-9H,2-4H2,1H3/t5-,6+,7-/m0/s1 |
| InChIKey | NBYJCGWVKLTFNF-XVMARJQXSA-N |
| XLogP | -0.09 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |