C9H16O5 — CID 137402322
(4aS,8aS)-2-(hydroxymethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3,7-diol (PubChem CID 137402322) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is (4aS,8aS)-2-(hydroxymethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3,7-diol.
| Compound Name | (4aS,8aS)-2-(hydroxymethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3,7-diol |
|---|---|
| PubChem CID | 137402322 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (4aS,8aS)-2-(hydroxymethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3,7-diol |
| SMILES | OCC1O[C@H]2CC(O)CO[C@H]2CC1O |
| InChI | InChI=1S/C9H16O5/c10-3-9-6(12)2-7-8(14-9)1-5(11)4-13-7/h5-12H,1-4H2/t5?,6?,7-,8-,9?/m0/s1 |
| InChIKey | MPVDPNKXGKOBGM-MCWCHSRNSA-N |
| XLogP | -1.35 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |