C7H14O3 — CID 163705595
(2R,3R,5S)-5-ethyloxane-2,3-diol (PubChem CID 163705595) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is (2R,3R,5S)-5-ethyloxane-2,3-diol.
| Compound Name | (2R,3R,5S)-5-ethyloxane-2,3-diol |
|---|---|
| PubChem CID | 163705595 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (2R,3R,5S)-5-ethyloxane-2,3-diol |
| SMILES | CC[C@@H]1CO[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C7H14O3/c1-2-5-3-6(8)7(9)10-4-5/h5-9H,2-4H2,1H3/t5-,6+,7+/m0/s1 |
| InChIKey | KEUAOEBAVQLNHF-RRKCRQDMSA-N |
| XLogP | 0.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |