C10H20O2 — CID 131848104
(2R,4S)-2-butoxy-4-ethyloxolane (PubChem CID 131848104) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (2R,4S)-2-butoxy-4-ethyloxolane.
| Compound Name | (2R,4S)-2-butoxy-4-ethyloxolane |
|---|---|
| PubChem CID | 131848104 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (2R,4S)-2-butoxy-4-ethyloxolane |
| SMILES | CCCCO[C@H]1C[C@H](CC)CO1 |
| InChI | InChI=1S/C10H20O2/c1-3-5-6-11-10-7-9(4-2)8-12-10/h9-10H,3-8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | DIZWMNYGGOWYPH-VHSXEESVSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|