C12H25NO3 — CID 20511445
2,5-dibutoxymorpholine (PubChem CID 20511445) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 2,5-dibutoxymorpholine.
| Compound Name | 2,5-dibutoxymorpholine |
|---|---|
| PubChem CID | 20511445 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 2,5-dibutoxymorpholine |
| SMILES | CCCCOC1COC(OCCCC)CN1 |
| InChI | InChI=1S/C12H25NO3/c1-3-5-7-14-11-10-16-12(9-13-11)15-8-6-4-2/h11-13H,3-10H2,1-2H3 |
| InChIKey | FAZQYRQYUWDHKL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|