C13H22O2 — CID 11790491
2-butoxy-4-[(2E)-penta-2,4-dien-2-yl]oxolane (PubChem CID 11790491) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-butoxy-4-[(2E)-penta-2,4-dien-2-yl]oxolane.
| Compound Name | 2-butoxy-4-[(2E)-penta-2,4-dien-2-yl]oxolane |
|---|---|
| PubChem CID | 11790491 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-butoxy-4-[(2E)-penta-2,4-dien-2-yl]oxolane |
| SMILES | C=C/C=C(\C)C1COC(OCCCC)C1 |
| InChI | InChI=1S/C13H22O2/c1-4-6-8-14-13-9-12(10-15-13)11(3)7-5-2/h5,7,12-13H,2,4,6,8-10H2,1,3H3/b11-7+ |
| InChIKey | SHTVTGBJVXRTGY-YRNVUSSQSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|