C12H22O2 — CID 135009088
(2R,3R)-5-butoxy-3-ethenyl-2,3-dimethyloxolane (PubChem CID 135009088) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (2R,3R)-5-butoxy-3-ethenyl-2,3-dimethyloxolane.
| Compound Name | (2R,3R)-5-butoxy-3-ethenyl-2,3-dimethyloxolane |
|---|---|
| PubChem CID | 135009088 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (2R,3R)-5-butoxy-3-ethenyl-2,3-dimethyloxolane |
| SMILES | C=C[C@@]1(C)CC(OCCCC)O[C@@H]1C |
| InChI | InChI=1S/C12H22O2/c1-5-7-8-13-11-9-12(4,6-2)10(3)14-11/h6,10-11H,2,5,7-9H2,1,3-4H3/t10-,11?,12+/m1/s1 |
| InChIKey | XYLWYUFPHKYORP-LWALXPGCSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|