C21H42O4 — CID 71163839
(2S,3R,6S)-3,4,5-tributoxy-2-methyl-6-propan-2-yloxane (PubChem CID 71163839) has the molecular formula C21H42O4 and a molecular weight of 358.56 g/mol. Its IUPAC name is (2S,3R,6S)-3,4,5-tributoxy-2-methyl-6-propan-2-yloxane.
| Compound Name | (2S,3R,6S)-3,4,5-tributoxy-2-methyl-6-propan-2-yloxane |
|---|---|
| PubChem CID | 71163839 |
| Molecular Formula | C21H42O4 |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | (2S,3R,6S)-3,4,5-tributoxy-2-methyl-6-propan-2-yloxane |
| SMILES | CCCCOC1C(OCCCC)[C@H](OCCCC)[C@H](C)O[C@H]1C(C)C |
| InChI | InChI=1S/C21H42O4/c1-7-10-13-22-19-17(6)25-18(16(4)5)20(23-14-11-8-2)21(19)24-15-12-9-3/h16-21H,7-15H2,1-6H3/t17-,18-,19+,20?,21?/m0/s1 |
| InChIKey | XVOCQFHWWJZVCY-DOIVMEMASA-N |
| XLogP | 4.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|