C13H24O2 — CID 86227518
2-butoxy-6-methyl-4-propan-2-yl-3,4-dihydro-2H-pyran (PubChem CID 86227518) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2-butoxy-6-methyl-4-propan-2-yl-3,4-dihydro-2H-pyran.
| Compound Name | 2-butoxy-6-methyl-4-propan-2-yl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 86227518 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2-butoxy-6-methyl-4-propan-2-yl-3,4-dihydro-2H-pyran |
| SMILES | CCCCOC1CC(C(C)C)C=C(C)O1 |
| InChI | InChI=1S/C13H24O2/c1-5-6-7-14-13-9-12(10(2)3)8-11(4)15-13/h8,10,12-13H,5-7,9H2,1-4H3 |
| InChIKey | QOBWDUUGIDDPTP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|