C10H16O3 — CID 14667618
(2R)-2-butoxy-6-methyl-2,3-dihydropyran-4-one (PubChem CID 14667618) has the molecular formula C10H16O3 and a molecular weight of 184.24 g/mol. Its IUPAC name is (2R)-2-butoxy-6-methyl-2,3-dihydropyran-4-one.
| Compound Name | (2R)-2-butoxy-6-methyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 14667618 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (2R)-2-butoxy-6-methyl-2,3-dihydropyran-4-one |
| SMILES | CCCCO[C@H]1CC(=O)C=C(C)O1 |
| InChI | InChI=1S/C10H16O3/c1-3-4-5-12-10-7-9(11)6-8(2)13-10/h6,10H,3-5,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | HAMQNLOAGKAYQE-SNVBAGLBSA-N |
| XLogP | 2.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|