C16H18O2 — CID 71816977
2-butoxy-2,3-dihydrobenzo[g][1]benzofuran (PubChem CID 71816977) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-butoxy-2,3-dihydrobenzo[g][1]benzofuran.
| Compound Name | 2-butoxy-2,3-dihydrobenzo[g][1]benzofuran |
|---|---|
| PubChem CID | 71816977 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-butoxy-2,3-dihydrobenzo[g][1]benzofuran |
| SMILES | CCCCOC1Cc2ccc3ccccc3c2O1 |
| InChI | InChI=1S/C16H18O2/c1-2-3-10-17-15-11-13-9-8-12-6-4-5-7-14(12)16(13)18-15/h4-9,15H,2-3,10-11H2,1H3 |
| InChIKey | XMVHGONEBDVBER-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|