C13H18O3 — CID 154992776
(3S)-3-butoxy-2-methyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 154992776) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (3S)-3-butoxy-2-methyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | (3S)-3-butoxy-2-methyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 154992776 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (3S)-3-butoxy-2-methyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCCCO[C@H]1Oc2ccccc2OC1C |
| InChI | InChI=1S/C13H18O3/c1-3-4-9-14-13-10(2)15-11-7-5-6-8-12(11)16-13/h5-8,10,13H,3-4,9H2,1-2H3/t10?,13-/m0/s1 |
| InChIKey | LCDOGYCBQGSMHO-HQVZTVAUSA-N |
| XLogP | 2.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|