C11H22O5 — CID 162936951
2-butoxy-4,6-dimethyloxane-3,4,5-triol (PubChem CID 162936951) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-butoxy-4,6-dimethyloxane-3,4,5-triol.
| Compound Name | 2-butoxy-4,6-dimethyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 162936951 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-butoxy-4,6-dimethyloxane-3,4,5-triol |
| SMILES | CCCCOC1OC(C)C(O)C(C)(O)C1O |
| InChI | InChI=1S/C11H22O5/c1-4-5-6-15-10-9(13)11(3,14)8(12)7(2)16-10/h7-10,12-14H,4-6H2,1-3H3 |
| InChIKey | KOASSBQKBFHBBF-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|