About 2-butoxy-3-methyloxirane
2-butoxy-3-methyloxirane (PubChem CID 87674208) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is 2-butoxy-3-methyloxirane.
Molecular Properties
| Compound Name | 2-butoxy-3-methyloxirane |
| PubChem CID | 87674208 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 2-butoxy-3-methyloxirane |
| SMILES | CCCCOC1OC1C |
| InChI | InChI=1S/C7H14O2/c1-3-4-5-8-7-6(2)9-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | CUIODKLCVPKRIF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-3-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-3-methyloxirane?
The IUPAC name of 2-butoxy-3-methyloxirane (CID 87674208) is 2-butoxy-3-methyloxirane.
What is the SMILES notation for 2-butoxy-3-methyloxirane?
The canonical SMILES for 2-butoxy-3-methyloxirane is CCCCOC1OC1C.
What is the InChIKey of 2-butoxy-3-methyloxirane?
The InChIKey is CUIODKLCVPKRIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-3-4-5-8-7-6(2)9-7/h6-7H,3-5H2,1-2H3.
What are the key properties of 2-butoxy-3-methyloxirane?
2-butoxy-3-methyloxirane has a molecular weight of 130.19 g/mol, XLogP of 1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-3-methyloxirane is sourced from PubChem (CID 87674208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).