C14H28O2 — CID 59926190
(2R,3S,4S,5R)-2,3,4,6-tetramethyl-5-pentoxyoxane (PubChem CID 59926190) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4,6-tetramethyl-5-pentoxyoxane.
| Compound Name | (2R,3S,4S,5R)-2,3,4,6-tetramethyl-5-pentoxyoxane |
|---|---|
| PubChem CID | 59926190 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4,6-tetramethyl-5-pentoxyoxane |
| SMILES | CCCCCO[C@H]1C(C)O[C@H](C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C14H28O2/c1-6-7-8-9-15-14-11(3)10(2)12(4)16-13(14)5/h10-14H,6-9H2,1-5H3/t10-,11-,12+,13?,14+/m0/s1 |
| InChIKey | LZAYBUFBODCROX-BEUHCMRWSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|