C25H54O4Si2 — CID 101239114
triethyl-[(2S,3S,4S,6S)-6-heptoxy-2-methyl-3-triethylsilyloxyoxan-4-yl]oxysilane (PubChem CID 101239114) has the molecular formula C25H54O4Si2 and a molecular weight of 474.88 g/mol. Its IUPAC name is triethyl-[(2S,3S,4S,6S)-6-heptoxy-2-methyl-3-triethylsilyloxyoxan-4-yl]oxysilane.
| Compound Name | triethyl-[(2S,3S,4S,6S)-6-heptoxy-2-methyl-3-triethylsilyloxyoxan-4-yl]oxysilane |
|---|---|
| PubChem CID | 101239114 |
| Molecular Formula | C25H54O4Si2 |
| Molecular Weight | 474.88 g/mol |
| Exact Mass | 474.36 |
| IUPAC Name | triethyl-[(2S,3S,4S,6S)-6-heptoxy-2-methyl-3-triethylsilyloxyoxan-4-yl]oxysilane |
| SMILES | CCCCCCCO[C@@H]1C[C@H](O[Si](CC)(CC)CC)[C@@H](O[Si](CC)(CC)CC)[C@H](C)O1 |
| InChI | InChI=1S/C25H54O4Si2/c1-9-16-17-18-19-20-26-24-21-23(28-30(10-2,11-3)12-4)25(22(8)27-24)29-31(13-5,14-6)15-7/h22-25H,9-21H2,1-8H3/t22-,23-,24-,25-/m0/s1 |
| InChIKey | KYUYYJVAEROYMF-QORCZRPOSA-N |
| XLogP | 7.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.88 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|