C11H22O4 — CID 146246874
(2S,6R)-2-(hydroxymethyl)-6-pentoxyoxan-4-ol (PubChem CID 146246874) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is (2S,6R)-2-(hydroxymethyl)-6-pentoxyoxan-4-ol.
| Compound Name | (2S,6R)-2-(hydroxymethyl)-6-pentoxyoxan-4-ol |
|---|---|
| PubChem CID | 146246874 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (2S,6R)-2-(hydroxymethyl)-6-pentoxyoxan-4-ol |
| SMILES | CCCCCO[C@H]1CC(O)C[C@@H](CO)O1 |
| InChI | InChI=1S/C11H22O4/c1-2-3-4-5-14-11-7-9(13)6-10(8-12)15-11/h9-13H,2-8H2,1H3/t9?,10-,11+/m0/s1 |
| InChIKey | WFOZTTGUUMFHIE-QXXIUIOUSA-N |
| XLogP | 1.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|