C22H40N2O6 — CID 11384884
(2S,3R,4R,6R)-6-[4-[(2R,4R,5R,6S)-4-(15N)azanyl-6-methyl-5-prop-2-enoxyoxan-2-yl]oxybutoxy]-2-methyl-3-prop-2-enoxyoxan-4-amine (PubChem CID 11384884) has the molecular formula C22H40N2O6 and a molecular weight of 430.56 g/mol. Its IUPAC name is (2S,3R,4R,6R)-6-[4-[(2R,4R,5R,6S)-4-(15N)azanyl-6-methyl-5-prop-2-enoxyoxan-2-yl]oxybutoxy]-2-methyl-3-prop-2-enoxyoxan-4-amine.
| Compound Name | (2S,3R,4R,6R)-6-[4-[(2R,4R,5R,6S)-4-(15N)azanyl-6-methyl-5-prop-2-enoxyoxan-2-yl]oxybutoxy]-2-methyl-3-prop-2-enoxyoxan-4-amine |
|---|---|
| PubChem CID | 11384884 |
| Molecular Formula | C22H40N2O6 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | (2S,3R,4R,6R)-6-[4-[(2R,4R,5R,6S)-4-(15N)azanyl-6-methyl-5-prop-2-enoxyoxan-2-yl]oxybutoxy]-2-methyl-3-prop-2-enoxyoxan-4-amine |
| SMILES | C=CCO[C@@H]1[C@H]([15NH2])C[C@H](OCCCCO[C@H]2C[C@@H]([15NH2])[C@@H](OCC=C)[C@H](C)O2)O[C@H]1C |
| InChI | InChI=1S/C22H40N2O6/c1-5-9-27-21-15(3)29-19(13-17(21)23)25-11-7-8-12-26-20-14-18(24)22(16(4)30-20)28-10-6-2/h5-6,15-22H,1-2,7-14,23-24H2,3-4H3/t15-,16-,17+,18+,19+,20+,21-,22-/m0/s1/i23+1,24+1 |
| InChIKey | NMFHPSTXCNDWQE-DMYJIHDPSA-N |
| XLogP | 1.87 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|