About 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane
2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane (PubChem CID 158078208) has the molecular formula C10H17F3O3
and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane.
Molecular Properties
| Compound Name | 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane |
| PubChem CID | 158078208 |
| Molecular Formula | C10H17F3O3 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane |
| SMILES | CCCCOC1OC1C.FC(F)(F)C1CO1 |
| InChI | InChI=1S/C7H14O2.C3H3F3O/c1-3-4-5-8-7-6(2)9-7;4-3(5,6)2-1-7-2/h6-7H,3-5H2,1-2H3;2H,1H2 |
| InChIKey | FMPYIFNYNUCDMA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane?
The IUPAC name of 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane (CID 158078208) is 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane.
What is the SMILES notation for 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane?
The canonical SMILES for 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane is CCCCOC1OC1C.FC(F)(F)C1CO1.
What is the InChIKey of 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane?
The InChIKey is FMPYIFNYNUCDMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.C3H3F3O/c1-3-4-5-8-7-6(2)9-7;4-3(5,6)2-1-7-2/h6-7H,3-5H2,1-2H3;2H,1H2.
What are the key properties of 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane?
2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane has a molecular weight of 242.24 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-3-methyloxirane;2-(trifluoromethyl)oxirane is sourced from PubChem (CID 158078208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).