C10H13ClO2 — CID 172752983
2-propyl-1,3-benzodioxole;hydrochloride (PubChem CID 172752983) has the molecular formula C10H13ClO2 and a molecular weight of 200.67 g/mol. Its IUPAC name is 2-propyl-1,3-benzodioxole;hydrochloride.
| Compound Name | 2-propyl-1,3-benzodioxole;hydrochloride |
|---|---|
| PubChem CID | 172752983 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-propyl-1,3-benzodioxole;hydrochloride |
| SMILES | CCCC1Oc2ccccc2O1.Cl |
| InChI | InChI=1S/C10H12O2.ClH/c1-2-5-10-11-8-6-3-4-7-9(8)12-10;/h3-4,6-7,10H,2,5H2,1H3;1H |
| InChIKey | KQBAKUYCOKUANC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |