C9H11NO2 — CID 4271632
N,N-dimethyl-1,3-benzodioxol-2-amine (PubChem CID 4271632) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is N,N-dimethyl-1,3-benzodioxol-2-amine.
| Compound Name | N,N-dimethyl-1,3-benzodioxol-2-amine |
|---|---|
| PubChem CID | 4271632 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | N,N-dimethyl-1,3-benzodioxol-2-amine |
| SMILES | CN(C)C1Oc2ccccc2O1 |
| InChI | InChI=1S/C9H11NO2/c1-10(2)9-11-7-5-3-4-6-8(7)12-9/h3-6,9H,1-2H3 |
| InChIKey | PTRJIHOWWFCGLZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |