C8H6O3 — CID 10534823
(1aR,7aS)-1a,7a-dihydrooxireno[2,3-b][1,4]benzodioxine (PubChem CID 10534823) has the molecular formula C8H6O3 and a molecular weight of 150.13 g/mol. Its IUPAC name is (1aR,7aS)-1a,7a-dihydrooxireno[2,3-b][1,4]benzodioxine.
| Compound Name | (1aR,7aS)-1a,7a-dihydrooxireno[2,3-b][1,4]benzodioxine |
|---|---|
| PubChem CID | 10534823 |
| Molecular Formula | C8H6O3 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | (1aR,7aS)-1a,7a-dihydrooxireno[2,3-b][1,4]benzodioxine |
| SMILES | c1ccc2c(c1)O[C@@H]1O[C@@H]1O2 |
| InChI | InChI=1S/C8H6O3/c1-2-4-6-5(3-1)9-7-8(10-6)11-7/h1-4,7-8H/t7-,8+ |
| InChIKey | OJKDJNGFHSXCAT-OCAPTIKFSA-N |
| XLogP | 1.14 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|