About 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran
2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran (PubChem CID 19848130) has the molecular formula C9H8O2
and a molecular weight of 148.16 g/mol. Its IUPAC name is 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran.
Molecular Properties
| Compound Name | 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran |
| PubChem CID | 19848130 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran |
| SMILES | c1ccc2c(c1)OC1OCC21 |
| InChI | InChI=1S/C9H8O2/c1-2-4-8-6(3-1)7-5-10-9(7)11-8/h1-4,7,9H,5H2 |
| InChIKey | SYRVLKJMOLXLGP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran?
The IUPAC name of 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran (CID 19848130) is 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran.
What is the SMILES notation for 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran?
The canonical SMILES for 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran is c1ccc2c(c1)OC1OCC21.
What is the InChIKey of 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran?
The InChIKey is SYRVLKJMOLXLGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2/c1-2-4-8-6(3-1)7-5-10-9(7)11-8/h1-4,7,9H,5H2.
What are the key properties of 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran?
2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran has a molecular weight of 148.16 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2a,7a-dihydro-2H-oxeto[2,3-b][1]benzofuran is sourced from PubChem (CID 19848130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).