C13H16O — CID 142978777
4-methyl-1,2,3,4,4a,9b-hexahydrodibenzofuran (PubChem CID 142978777) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-methyl-1,2,3,4,4a,9b-hexahydrodibenzofuran.
| Compound Name | 4-methyl-1,2,3,4,4a,9b-hexahydrodibenzofuran |
|---|---|
| PubChem CID | 142978777 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 4-methyl-1,2,3,4,4a,9b-hexahydrodibenzofuran |
| SMILES | CC1CCCC2c3ccccc3OC12 |
| InChI | InChI=1S/C13H16O/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11/h2-3,6,8-9,11,13H,4-5,7H2,1H3 |
| InChIKey | HISAFXYXNXXRBX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |