C13H19N — CID 124577862
2-[(1S,2S)-2-methylcyclohexyl]aniline (PubChem CID 124577862) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-[(1S,2S)-2-methylcyclohexyl]aniline.
| Compound Name | 2-[(1S,2S)-2-methylcyclohexyl]aniline |
|---|---|
| PubChem CID | 124577862 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-[(1S,2S)-2-methylcyclohexyl]aniline |
| SMILES | C[C@H]1CCCC[C@@H]1c1ccccc1N |
| InChI | InChI=1S/C13H19N/c1-10-6-2-3-7-11(10)12-8-4-5-9-13(12)14/h4-5,8-11H,2-3,6-7,14H2,1H3/t10-,11-/m0/s1 |
| InChIKey | AWOMMNJENIXHKL-QWRGUYRKSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|