C14H21N — CID 125450180
3-methyl-2-[(1S,2S)-2-methylcyclohexyl]aniline (PubChem CID 125450180) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 3-methyl-2-[(1S,2S)-2-methylcyclohexyl]aniline.
| Compound Name | 3-methyl-2-[(1S,2S)-2-methylcyclohexyl]aniline |
|---|---|
| PubChem CID | 125450180 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 3-methyl-2-[(1S,2S)-2-methylcyclohexyl]aniline |
| SMILES | Cc1cccc(N)c1[C@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C14H21N/c1-10-6-3-4-8-12(10)14-11(2)7-5-9-13(14)15/h5,7,9-10,12H,3-4,6,8,15H2,1-2H3/t10-,12-/m0/s1 |
| InChIKey | VIUGHPXNEUIZTH-JQWIXIFHSA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|