About N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline
N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline (PubChem CID 174940718) has the molecular formula C16H28N2
and a molecular weight of 248.41 g/mol. Its IUPAC name is N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline.
Molecular Properties
| Compound Name | N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline |
| PubChem CID | 174940718 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline |
| SMILES | CCNC1CCCCC1C.Cc1ccccc1N |
| InChI | InChI=1S/C9H19N.C7H9N/c1-3-10-9-7-5-4-6-8(9)2;1-6-4-2-3-5-7(6)8/h8-10H,3-7H2,1-2H3;2-5H,8H2,1H3 |
| InChIKey | NOCWHEPADIMDTO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline?
The IUPAC name of N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline (CID 174940718) is N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline.
What is the SMILES notation for N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline?
The canonical SMILES for N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline is CCNC1CCCCC1C.Cc1ccccc1N.
What is the InChIKey of N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline?
The InChIKey is NOCWHEPADIMDTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C7H9N/c1-3-10-9-7-5-4-6-8(9)2;1-6-4-2-3-5-7(6)8/h8-10H,3-7H2,1-2H3;2-5H,8H2,1H3.
What are the key properties of N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline?
N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline has a molecular weight of 248.41 g/mol, XLogP of 3.75, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methylcyclohexan-1-amine;2-methylaniline is sourced from PubChem (CID 174940718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).