C12H16ClNO — CID 175798216
(4aR,10bS)-2,3,4,4a,5,10b-hexahydro-1H-chromeno[3,4-c]pyridine;hydrochloride (PubChem CID 175798216) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is (4aR,10bS)-2,3,4,4a,5,10b-hexahydro-1H-chromeno[3,4-c]pyridine;hydrochloride.
| Compound Name | (4aR,10bS)-2,3,4,4a,5,10b-hexahydro-1H-chromeno[3,4-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 175798216 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (4aR,10bS)-2,3,4,4a,5,10b-hexahydro-1H-chromeno[3,4-c]pyridine;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)OC[C@H]1CNCC[C@H]21 |
| InChI | InChI=1S/C12H15NO.ClH/c1-2-4-12-11(3-1)10-5-6-13-7-9(10)8-14-12;/h1-4,9-10,13H,5-8H2;1H/t9-,10+;/m1./s1 |
| InChIKey | UJDBLSPTLWBGIX-UXQCFNEQSA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |