C13H17NO2 — CID 70275125
(10bS)-10-methoxy-2,3,4,4a,5,10b-hexahydro-1H-chromeno[3,4-c]pyridine (PubChem CID 70275125) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (10bS)-10-methoxy-2,3,4,4a,5,10b-hexahydro-1H-chromeno[3,4-c]pyridine.
| Compound Name | (10bS)-10-methoxy-2,3,4,4a,5,10b-hexahydro-1H-chromeno[3,4-c]pyridine |
|---|---|
| PubChem CID | 70275125 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (10bS)-10-methoxy-2,3,4,4a,5,10b-hexahydro-1H-chromeno[3,4-c]pyridine |
| SMILES | COc1cccc2c1[C@H]1CCNCC1CO2 |
| InChI | InChI=1S/C13H17NO2/c1-15-11-3-2-4-12-13(11)10-5-6-14-7-9(10)8-16-12/h2-4,9-10,14H,5-8H2,1H3/t9?,10-/m0/s1 |
| InChIKey | FOVXWOWIEALDBR-AXDSSHIGSA-N |
| XLogP | 1.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |