C17H26N2O2 — CID 21309088
5-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]pentan-1-amine (PubChem CID 21309088) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 5-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]pentan-1-amine.
| Compound Name | 5-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]pentan-1-amine |
|---|---|
| PubChem CID | 21309088 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 5-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]pentan-1-amine |
| SMILES | COc1cccc2c1[C@@H]1CN(CCCCCN)C[C@H]1CO2 |
| InChI | InChI=1S/C17H26N2O2/c1-20-15-6-5-7-16-17(15)14-11-19(9-4-2-3-8-18)10-13(14)12-21-16/h5-7,13-14H,2-4,8-12,18H2,1H3/t13-,14+/m0/s1 |
| InChIKey | FJVOAHRSRDMVHM-UONOGXRCSA-N |
| XLogP | 2.23 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|