C27H28N4O4 — CID 21309039
3-[4-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-1H-pyrido[2,3-f]quinazoline-2,4-dione (PubChem CID 21309039) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 3-[4-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-1H-pyrido[2,3-f]quinazoline-2,4-dione.
| Compound Name | 3-[4-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-1H-pyrido[2,3-f]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 21309039 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 3-[4-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-1H-pyrido[2,3-f]quinazoline-2,4-dione |
| SMILES | COc1cccc2c1[C@@H]1CN(CCCCC3C(=O)Nc4c(ccc5ncncc45)C3=O)C[C@H]1CO2 |
| InChI | InChI=1S/C27H28N4O4/c1-34-22-6-4-7-23-24(22)20-13-31(12-16(20)14-35-23)10-3-2-5-18-26(32)17-8-9-21-19(11-28-15-29-21)25(17)30-27(18)33/h4,6-9,11,15-16,18,20H,2-3,5,10,12-14H2,1H3,(H,30,33)/t16-,18?,20+/m0/s1 |
| InChIKey | MOZGWCWFHOWXBZ-LYNLNPNLSA-N |
| XLogP | 3.67 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|