C27H29N3O4S — CID 15887917
3-[5-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]pentyl]-1H-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 15887917) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 3-[5-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]pentyl]-1H-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-[5-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]pentyl]-1H-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15887917 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 3-[5-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]pentyl]-1H-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | COc1cccc2c1[C@@H]1CN(CCCCCn3c(=O)[nH]c4c(sc5ccccc54)c3=O)C[C@@H]1CO2 |
| InChI | InChI=1S/C27H29N3O4S/c1-33-20-9-7-10-21-23(20)19-15-29(14-17(19)16-34-21)12-5-2-6-13-30-26(31)25-24(28-27(30)32)18-8-3-4-11-22(18)35-25/h3-4,7-11,17,19H,2,5-6,12-16H2,1H3,(H,28,32)/t17-,19-/m1/s1 |
| InChIKey | VMUHYNQVKMUGFO-IEBWSBKVSA-N |
| XLogP | 4.19 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|