C26H28N4O5S — CID 21308911
5-[4-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-13-methoxy-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione (PubChem CID 21308911) has the molecular formula C26H28N4O5S and a molecular weight of 508.60 g/mol. Its IUPAC name is 5-[4-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-13-methoxy-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione.
| Compound Name | 5-[4-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-13-methoxy-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
|---|---|
| PubChem CID | 21308911 |
| Molecular Formula | C26H28N4O5S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 5-[4-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-13-methoxy-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
| SMILES | COc1cccc2c1[C@@H]1CN(CCCCn3c(=O)[nH]c4c(sc5nccc(OC)c54)c3=O)C[C@@H]1CO2 |
| InChI | InChI=1S/C26H28N4O5S/c1-33-17-6-5-7-19-20(17)16-13-29(12-15(16)14-35-19)10-3-4-11-30-25(31)23-22(28-26(30)32)21-18(34-2)8-9-27-24(21)36-23/h5-9,15-16H,3-4,10-14H2,1-2H3,(H,28,32)/t15-,16-/m1/s1 |
| InChIKey | UPBXJLSNRNPIMN-HZPDHXFCSA-N |
| XLogP | 3.20 |
| TPSA | 98.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|