C25H25ClN4O4S — CID 21308916
5-[4-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-10-chloro-8-thia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione (PubChem CID 21308916) has the molecular formula C25H25ClN4O4S and a molecular weight of 513.02 g/mol. Its IUPAC name is 5-[4-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-10-chloro-8-thia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione.
| Compound Name | 5-[4-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-10-chloro-8-thia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
|---|---|
| PubChem CID | 21308916 |
| Molecular Formula | C25H25ClN4O4S |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 5-[4-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-10-chloro-8-thia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
| SMILES | COc1cccc2c1[C@@H]1CN(CCCCn3c(=O)[nH]c4c(sc5c(Cl)ccnc54)c3=O)C[C@H]1CO2 |
| InChI | InChI=1S/C25H25ClN4O4S/c1-33-17-5-4-6-18-19(17)15-12-29(11-14(15)13-34-18)9-2-3-10-30-24(31)23-21(28-25(30)32)20-22(35-23)16(26)7-8-27-20/h4-8,14-15H,2-3,9-13H2,1H3,(H,28,32)/t14-,15+/m0/s1 |
| InChIKey | HSUNHFJLVDCVQY-LSDHHAIUSA-N |
| XLogP | 3.85 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|