C24H25Cl2N5O4S — CID 21309017
5-[4-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-12-chloro-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione;hydrochloride (PubChem CID 21309017) has the molecular formula C24H25Cl2N5O4S and a molecular weight of 550.47 g/mol. Its IUPAC name is 5-[4-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-12-chloro-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione;hydrochloride.
| Compound Name | 5-[4-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-12-chloro-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione;hydrochloride |
|---|---|
| PubChem CID | 21309017 |
| Molecular Formula | C24H25Cl2N5O4S |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 5-[4-[(3aS,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-12-chloro-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione;hydrochloride |
| SMILES | COc1cccc2c1[C@@H]1CN(CCCCn3c(=O)[nH]c4c(sc5ncc(Cl)nc54)c3=O)C[C@H]1CO2.Cl |
| InChI | InChI=1S/C24H24ClN5O4S.ClH/c1-33-15-5-4-6-16-18(15)14-11-29(10-13(14)12-34-16)7-2-3-8-30-23(31)21-19(28-24(30)32)20-22(35-21)26-9-17(25)27-20;/h4-6,9,13-14H,2-3,7-8,10-12H2,1H3,(H,28,32);1H/t13-,14+;/m0./s1 |
| InChIKey | FNKGIDCNPPOCQX-LMRHVHIWSA-N |
| XLogP | 3.67 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|