C24H25ClN6O4S — CID 10208629
12-chloro-5-[4-(10-methoxy-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl)butyl]-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione (PubChem CID 10208629) has the molecular formula C24H25ClN6O4S and a molecular weight of 529.02 g/mol. Its IUPAC name is 12-chloro-5-[4-(10-methoxy-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl)butyl]-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione.
| Compound Name | 12-chloro-5-[4-(10-methoxy-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl)butyl]-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
|---|---|
| PubChem CID | 10208629 |
| Molecular Formula | C24H25ClN6O4S |
| Molecular Weight | 529.02 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 12-chloro-5-[4-(10-methoxy-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-3-yl)butyl]-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
| SMILES | COc1cccc2c1N1CCN(CCCCn3c(=O)[nH]c4c(sc5ncc(Cl)nc54)c3=O)CC1CO2 |
| InChI | InChI=1S/C24H25ClN6O4S/c1-34-15-5-4-6-16-20(15)30-10-9-29(12-14(30)13-35-16)7-2-3-8-31-23(32)21-18(28-24(31)33)19-22(36-21)26-11-17(25)27-19/h4-6,11,14H,2-3,7-10,12-13H2,1H3,(H,28,33) |
| InChIKey | LQNGCZUUUWNCSI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.02 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|