C26H27N5O4 — CID 70204878
3-[4-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-1H-pyrimido[5,4-h]quinazoline-2,4-dione (PubChem CID 70204878) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is 3-[4-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-1H-pyrimido[5,4-h]quinazoline-2,4-dione.
| Compound Name | 3-[4-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-1H-pyrimido[5,4-h]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 70204878 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 3-[4-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-1H-pyrimido[5,4-h]quinazoline-2,4-dione |
| SMILES | COc1cccc2c1[C@@H]1CN(CCCCn3c(=O)[nH]c4c(ccc5cncnc54)c3=O)C[C@@H]1CO2 |
| InChI | InChI=1S/C26H27N5O4/c1-34-20-5-4-6-21-22(20)19-13-30(12-17(19)14-35-21)9-2-3-10-31-25(32)18-8-7-16-11-27-15-28-23(16)24(18)29-26(31)33/h4-8,11,15,17,19H,2-3,9-10,12-14H2,1H3,(H,29,33)/t17-,19-/m1/s1 |
| InChIKey | INASKJVGRYLTCV-IEBWSBKVSA-N |
| XLogP | 2.53 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|