C26H27N3O3S — CID 10601380
3-[3-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]propyl]-1H-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 10601380) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 3-[3-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]propyl]-1H-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-[3-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]propyl]-1H-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10601380 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 3-[3-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]propyl]-1H-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | COc1cccc2c1CC[C@H]1CN(CCCn3c(=O)[nH]c4c(sc5ccccc54)c3=O)C[C@@H]21 |
| InChI | InChI=1S/C26H27N3O3S/c1-32-21-8-4-7-17-18(21)11-10-16-14-28(15-20(16)17)12-5-13-29-25(30)24-23(27-26(29)31)19-6-2-3-9-22(19)33-24/h2-4,6-9,16,20H,5,10-15H2,1H3,(H,27,31)/t16-,20+/m0/s1 |
| InChIKey | JSVIAXKQDMQOAP-OXJNMPFZSA-N |
| XLogP | 3.96 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |