C25H26ClN3O3S — CID 10648541
3-[2-[(3aS,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-1H-[1]benzothiolo[3,2-d]pyrimidin-1-ium-2,4-dione chloride (PubChem CID 10648541) has the molecular formula C25H26ClN3O3S and a molecular weight of 484.02 g/mol. Its IUPAC name is 3-[2-[(3aS,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-1H-[1]benzothiolo[3,2-d]pyrimidin-1-ium-2,4-dione chloride.
| Compound Name | 3-[2-[(3aS,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-1H-[1]benzothiolo[3,2-d]pyrimidin-1-ium-2,4-dione chloride |
|---|---|
| PubChem CID | 10648541 |
| Molecular Formula | C25H26ClN3O3S |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 3-[2-[(3aS,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-1H-[1]benzothiolo[3,2-d]pyrimidin-1-ium-2,4-dione chloride |
| SMILES | COc1cccc2c1CC[C@@H]1CN(CCN3C(=O)[NH2+]c4c(sc5ccccc45)C3=O)C[C@@H]21.[Cl-] |
| InChI | InChI=1S/C25H25N3O3S.ClH/c1-31-20-7-4-6-16-17(20)10-9-15-13-27(14-19(15)16)11-12-28-24(29)23-22(26-25(28)30)18-5-2-3-8-21(18)32-23;/h2-8,15,19H,9-14H2,1H3,(H,26,30);1H/t15-,19-;/m1./s1 |
| InChIKey | BGMVTQQZZGUZJT-AEFICSSHSA-N |
| XLogP | 0.35 |
| TPSA | 66.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |