C26H25ClF3N3O3S — CID 10530731
3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-7-(trifluoromethyl)-1H-[1]benzothiolo[3,2-d]pyrimidin-1-ium-2,4-dione chloride (PubChem CID 10530731) has the molecular formula C26H25ClF3N3O3S and a molecular weight of 552.02 g/mol. Its IUPAC name is 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-7-(trifluoromethyl)-1H-[1]benzothiolo[3,2-d]pyrimidin-1-ium-2,4-dione chloride.
| Compound Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-7-(trifluoromethyl)-1H-[1]benzothiolo[3,2-d]pyrimidin-1-ium-2,4-dione chloride |
|---|---|
| PubChem CID | 10530731 |
| Molecular Formula | C26H25ClF3N3O3S |
| Molecular Weight | 552.02 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-7-(trifluoromethyl)-1H-[1]benzothiolo[3,2-d]pyrimidin-1-ium-2,4-dione chloride |
| SMILES | COc1cccc2c1CC[C@H]1CN(CCN3C(=O)[NH2+]c4c(sc5cc(C(F)(F)F)ccc45)C3=O)C[C@@H]21.[Cl-] |
| InChI | InChI=1S/C26H24F3N3O3S.ClH/c1-35-20-4-2-3-16-17(20)7-5-14-12-31(13-19(14)16)9-10-32-24(33)23-22(30-25(32)34)18-8-6-15(26(27,28)29)11-21(18)36-23;/h2-4,6,8,11,14,19H,5,7,9-10,12-13H2,1H3,(H,30,34);1H/t14-,19+;/m0./s1 |
| InChIKey | OFIJQXSZQJKJFQ-OWRLQCHVSA-N |
| XLogP | 1.37 |
| TPSA | 66.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.02 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |