C13H18ClNO — CID 10847615
(3aS,9bS)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindol-2-ium chloride (PubChem CID 10847615) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is (3aS,9bS)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindol-2-ium chloride.
| Compound Name | (3aS,9bS)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindol-2-ium chloride |
|---|---|
| PubChem CID | 10847615 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (3aS,9bS)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindol-2-ium chloride |
| SMILES | COc1cccc2c1CC[C@@H]1C[NH2+]C[C@H]21.[Cl-] |
| InChI | InChI=1S/C13H17NO.ClH/c1-15-13-4-2-3-10-11(13)6-5-9-7-14-8-12(9)10;/h2-4,9,12,14H,5-8H2,1H3;1H/t9-,12+;/m1./s1 |
| InChIKey | SGMRZWNYQUCOKI-KATIXKQHSA-N |
| XLogP | -2.08 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |