C21H25NO — CID 10614708
(3aR,9bR)-6-methoxy-2-[(1S)-1-phenylethyl]-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole (PubChem CID 10614708) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is (3aR,9bR)-6-methoxy-2-[(1S)-1-phenylethyl]-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole.
| Compound Name | (3aR,9bR)-6-methoxy-2-[(1S)-1-phenylethyl]-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
|---|---|
| PubChem CID | 10614708 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (3aR,9bR)-6-methoxy-2-[(1S)-1-phenylethyl]-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
| SMILES | COc1cccc2c1CC[C@H]1CN([C@@H](C)c3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C21H25NO/c1-15(16-7-4-3-5-8-16)22-13-17-11-12-19-18(20(17)14-22)9-6-10-21(19)23-2/h3-10,15,17,20H,11-14H2,1-2H3/t15-,17-,20+/m0/s1 |
| InChIKey | UHMQHQCWMYQOEO-RIFZZMRRSA-N |
| XLogP | 4.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |